Products 2375253-80-6

CAS 2375253-80-6 is the registry number for 1-(2-Fluoroethyl)piperidin-4-yl 4-methylbenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[1-(2-fluoroethyl)piperidin-4-yl] 4-methylbenzenesulfonate (CAS 2375253-80-6) is a chemical compound with the molecular formula C14H20FNO3S and a molecular weight of 301.38 g/mol. IUPAC name: [1-(2-fluoroethyl)piperidin-4-yl] 4-methylbenzenesulfonate. InChIKey: OAXVTVBCIFQXBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20FNO3S
Molecular weight301.38 g/mol
IUPAC name[1-(2-fluoroethyl)piperidin-4-yl] 4-methylbenzenesulfonate
InChIKeyOAXVTVBCIFQXBZ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OC2CCN(CC2)CCF

Computed by PubChem (NCBI)