CAS 608521-21-7 appears in our catalog under these names: Paroxetine Impurity 26, Paroxol Methanesulfonate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 500mg, 50mg.
[(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methyl methanesulfonate (CAS 608521-21-7) is a chemical compound with the molecular formula C14H20FNO3S and a molecular weight of 301.38 g/mol. IUPAC name: [(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methyl methanesulfonate. InChIKey: HAEFSUMMZPPOJC-JSGCOSHPSA-N.
| Molecular formula | C14H20FNO3S |
|---|---|
| Molecular weight | 301.38 g/mol |
| IUPAC name | [(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methyl methanesulfonate |
| InChIKey | HAEFSUMMZPPOJC-JSGCOSHPSA-N |
| SMILES | CN1CC[C@H]([C@@H](C1)COS(=O)(=O)C)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)