Products 2375262-29-4

CAS 2375262-29-4 is the registry number for 2-(5,5-Dimethyl-1,4-dioxan-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(5,5-dimethyl-1,4-dioxan-2-yl)acetic acid (CAS 2375262-29-4) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: 2-(5,5-dimethyl-1,4-dioxan-2-yl)acetic acid. InChIKey: MDAIVJNTBLGJDW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14O4
Molecular weight174.19 g/mol
IUPAC name2-(5,5-dimethyl-1,4-dioxan-2-yl)acetic acid
InChIKeyMDAIVJNTBLGJDW-UHFFFAOYSA-N
SMILESCC1(COC(CO1)CC(=O)O)C

Computed by PubChem (NCBI)