Products 2375269-90-0
CAS 2375269-90-0 is the registry number for 7-Acetyl-3-oxa-7-azabicyclo(3.3.1)nonane-2,4-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-acetyl-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione (CAS 2375269-90-0) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 7-acetyl-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione. InChIKey: FPVKGJLZWTUKQH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 7-acetyl-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione |
| InChIKey | FPVKGJLZWTUKQH-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2CC(C1)C(=O)OC2=O |
Computed by PubChem (NCBI)