CAS 2375274-19-2 is the registry number for 4-(4,4-Dimethylcyclohexyl)-1,3-thiazol-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(4,4-dimethylcyclohexyl)-1,3-thiazol-2-amine;hydrochloride (CAS 2375274-19-2) is a chemical compound with the molecular formula C11H19ClN2S and a molecular weight of 246.80 g/mol. IUPAC name: 4-(4,4-dimethylcyclohexyl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: DWIHJKDJAONXBO-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2S |
|---|---|
| Molecular weight | 246.80 g/mol |
| IUPAC name | 4-(4,4-dimethylcyclohexyl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | DWIHJKDJAONXBO-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)C2=CSC(=N2)N)C.Cl |
Computed by PubChem (NCBI)