CAS 676348-27-9 is the registry number for 6-(tert-Butyl)-4,5,6,7-tetrahydrobenzo(d)thiazol-2-amine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride (CAS 676348-27-9) is a chemical compound with the molecular formula C11H19ClN2S and a molecular weight of 246.80 g/mol. IUPAC name: 6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride. InChIKey: LUSDBQKOOJSQDW-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2S |
|---|---|
| Molecular weight | 246.80 g/mol |
| IUPAC name | 6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride |
| InChIKey | LUSDBQKOOJSQDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=N2)N.Cl |
Computed by PubChem (NCBI)