Products 2375528-15-5
CAS 2375528-15-5 is the registry number for tert-butyl 6-oxo-2,5-diazaspiro[3.5]nonane-2-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl 6-oxo-2,5-diazaspiro[3.5]nonane-2-carboxylate (CAS 2375528-15-5) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 6-oxo-2,5-diazaspiro[3.5]nonane-2-carboxylate. InChIKey: PCJQPONBYFEULW-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl 6-oxo-2,5-diazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | PCJQPONBYFEULW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCCC(=O)N2 |
Computed by PubChem (NCBI)