CAS 2375652-86-9 is the registry number for 2',5'-Dibromo-[1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2,5-dibromo-4-(4-formylphenyl)phenyl]benzaldehyde (CAS 2375652-86-9) is a chemical compound with the molecular formula C20H12Br2O2 and a molecular weight of 444.1 g/mol. IUPAC name: 4-[2,5-dibromo-4-(4-formylphenyl)phenyl]benzaldehyde. InChIKey: NMLUNSOZWYHTGW-UHFFFAOYSA-N.
| Molecular formula | C20H12Br2O2 |
|---|---|
| Molecular weight | 444.1 g/mol |
| IUPAC name | 4-[2,5-dibromo-4-(4-formylphenyl)phenyl]benzaldehyde |
| InChIKey | NMLUNSOZWYHTGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=C(C=C2Br)C3=CC=C(C=C3)C=O)Br |
Computed by PubChem (NCBI)