CAS 13185-00-7 appears in our catalog under these names: 6,6'–Dibromo–1,1'–bi–2–naphthol, (+/-)-6,6'-Dibromo-1,1'-bi-2-naphthol, >98.0%(T), 6,6'-Dibromo[1,1'-binaphthalene]-2,2'-diol, 98%, 98%, 6,6'-Dibromo-1,1'-bi-2-naphthol, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g, 2.5g.
6-bromo-1-(6-bromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol (CAS 13185-00-7) is a chemical compound with the molecular formula C20H12Br2O2 and a molecular weight of 444.1 g/mol. IUPAC name: 6-bromo-1-(6-bromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol. InChIKey: OORIFUHRGQKYEV-UHFFFAOYSA-N.
| Molecular formula | C20H12Br2O2 |
|---|---|
| Molecular weight | 444.1 g/mol |
| IUPAC name | 6-bromo-1-(6-bromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| InChIKey | OORIFUHRGQKYEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C3=C(C=CC4=C3C=CC(=C4)Br)O)O)C=C1Br |
Computed by PubChem (NCBI)