CAS 111795-43-8 appears in our catalog under these names: (R)–3,3'–Dibromo–1,1'–bi–2–naphthol, (R)-3,3'-Dibromo-1,1'-bi-2-naphthol, (R)-3,3'-Dibromo-1,1'-bi-2-naphthol, >98.0%(GC), (R)-(+)-3,3'-DIBROMO-1,1'-BI-2-NAPHTHOL&, (R)-3,3'-Dibromo-1,1'-bi-2-naphthol, 95%, 95%. Offered by: GLPBio, Biosynth, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 5g, 10000mg, 5000mg, 100mg, 10g, 25g.
3-bromo-1-(3-bromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol (CAS 111795-43-8) is a chemical compound with the molecular formula C20H12Br2O2 and a molecular weight of 444.1 g/mol. IUPAC name: 3-bromo-1-(3-bromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol. InChIKey: BRTBEAXHUYEXSY-UHFFFAOYSA-N.
| Molecular formula | C20H12Br2O2 |
|---|---|
| Molecular weight | 444.1 g/mol |
| IUPAC name | 3-bromo-1-(3-bromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| InChIKey | BRTBEAXHUYEXSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2C3=C(C(=CC4=CC=CC=C43)Br)O)O)Br |
Computed by PubChem (NCBI)