Products 2375653-10-2
CAS 2375653-10-2 is the registry number for (S)-1-benzyl-3,3-difluoropiperidin-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(4S)-1-benzyl-3,3-difluoropiperidin-4-ol (CAS 2375653-10-2) is a chemical compound with the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. IUPAC name: (4S)-1-benzyl-3,3-difluoropiperidin-4-ol. InChIKey: GQTXKSUYTZFNET-NSHDSACASA-N.
| Molecular formula | C12H15F2NO |
|---|---|
| Molecular weight | 227.25 g/mol |
| IUPAC name | (4S)-1-benzyl-3,3-difluoropiperidin-4-ol |
| InChIKey | GQTXKSUYTZFNET-NSHDSACASA-N |
| SMILES | C1CN(CC([C@H]1O)(F)F)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)