Products 2375779-31-8

CAS 2375779-31-8 is the registry number for GP130 modulator-1, 99.29%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 100 mg, 50 mg, 10mM/1mL, 5 mg, 25 mg.

Structural formula: {0} (CAS {1})

N-[4-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide (CAS 2375779-31-8) is a chemical compound with the molecular formula C16H15N3O4S and a molecular weight of 345.4 g/mol. IUPAC name: N-[4-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide. InChIKey: DNNLLPUPTRDXAP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15N3O4S
Molecular weight345.4 g/mol
IUPAC nameN-[4-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide
InChIKeyDNNLLPUPTRDXAP-UHFFFAOYSA-N
SMILESCOCCOC1=CC=C(C=C1)C2=CSC(=N2)NC(=O)C3=CC=NO3

Computed by PubChem (NCBI)

Synonyms: orb2695628