Products 311781-49-4
CAS 311781-49-4 is the registry number for (2-indol-3-ylethyl)((2-nitrophenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
N-[2-(1H-indol-3-yl)ethyl]-2-nitrobenzenesulfonamide (CAS 311781-49-4) is a chemical compound with the molecular formula C16H15N3O4S and a molecular weight of 345.4 g/mol. IUPAC name: N-[2-(1H-indol-3-yl)ethyl]-2-nitrobenzenesulfonamide. InChIKey: YLOFNUAWNFURLP-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O4S |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | N-[2-(1H-indol-3-yl)ethyl]-2-nitrobenzenesulfonamide |
| InChIKey | YLOFNUAWNFURLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNS(=O)(=O)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)