Products 2376423-07-1
CAS 2376423-07-1 is the registry number for N,N-Dimethyl-4-(1,3,5,6-tetramethyl-2,3-dihydro-1H-benzimidazol-2-yl)aniline, >95.0%(qNMR). Offered by: TCI. Available pack sizes: 1g, 5g.
N,N-dimethyl-4-(1,3,5,6-tetramethyl-2H-benzimidazol-2-yl)aniline (CAS 2376423-07-1) is a chemical compound with the molecular formula C19H25N3 and a molecular weight of 295.4 g/mol. IUPAC name: N,N-dimethyl-4-(1,3,5,6-tetramethyl-2H-benzimidazol-2-yl)aniline. InChIKey: MWGACEWNQCVTGO-UHFFFAOYSA-N.
| Molecular formula | C19H25N3 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | N,N-dimethyl-4-(1,3,5,6-tetramethyl-2H-benzimidazol-2-yl)aniline |
| InChIKey | MWGACEWNQCVTGO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C(N2C)C3=CC=C(C=C3)N(C)C)C |
Computed by PubChem (NCBI)