CAS 2376439-46-0 is the registry number for (R)-3-((tert-butoxycarbonyl)amino)-3-phenylpropyl methanesulfonate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl] methanesulfonate (CAS 2376439-46-0) is a chemical compound with the molecular formula C15H23NO5S and a molecular weight of 329.4 g/mol. IUPAC name: [(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl] methanesulfonate. InChIKey: CCGLKTLZIIQMEN-CYBMUJFWSA-N.
| Molecular formula | C15H23NO5S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | [(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl] methanesulfonate |
| InChIKey | CCGLKTLZIIQMEN-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCOS(=O)(=O)C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)