CAS 80909-96-2 appears in our catalog under these names: 3-((tert-Butoxycarbonyl)amino)propyl 4-methylbenzenesulfonate, 98%, 98%, 3-((tert-Butoxycarbonyl)amino)propyl 4-methylbenzenesulfonate, 98.0%, 3-((tert-Butoxycarbonyl)amino)propyl 4-methylbenzenesulfonate, 98%, 3-((tert-Butoxycarbonyl)amino)propyl 4-methylbenzenesulfonate, 97%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g, 10 g, 1 g, 5 g.
3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 4-methylbenzenesulfonate (CAS 80909-96-2) is a chemical compound with the molecular formula C15H23NO5S and a molecular weight of 329.4 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 4-methylbenzenesulfonate. InChIKey: KLKKIENVIGQBAG-UHFFFAOYSA-N.
| Molecular formula | C15H23NO5S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 4-methylbenzenesulfonate |
| InChIKey | KLKKIENVIGQBAG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)