CAS 2376634-17-0 is the registry number for Methyl (R)-2-(2,3,4-trichlorophenoxy)butanoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl (2R)-2-(2,3,4-trichlorophenoxy)butanoate (CAS 2376634-17-0) is a chemical compound with the molecular formula C11H11Cl3O3 and a molecular weight of 297.6 g/mol. IUPAC name: methyl (2R)-2-(2,3,4-trichlorophenoxy)butanoate. InChIKey: ARDJETQYYHSLCV-SSDOTTSWSA-N.
| Molecular formula | C11H11Cl3O3 |
|---|---|
| Molecular weight | 297.6 g/mol |
| IUPAC name | methyl (2R)-2-(2,3,4-trichlorophenoxy)butanoate |
| InChIKey | ARDJETQYYHSLCV-SSDOTTSWSA-N |
| SMILES | CC[C@H](C(=O)OC)OC1=C(C(=C(C=C1)Cl)Cl)Cl |
Computed by PubChem (NCBI)