CAS 94006-13-0 is the registry number for 1,1,1-Trichloro-2-methylpropan-2-yl 2-hydroxybenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1,1,1-trichloro-2-methylpropan-2-yl) 2-hydroxybenzoate (CAS 94006-13-0) is a chemical compound with the molecular formula C11H11Cl3O3 and a molecular weight of 297.6 g/mol. IUPAC name: (1,1,1-trichloro-2-methylpropan-2-yl) 2-hydroxybenzoate. InChIKey: JMBYJYPJYHTGKC-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl3O3 |
|---|---|
| Molecular weight | 297.6 g/mol |
| IUPAC name | (1,1,1-trichloro-2-methylpropan-2-yl) 2-hydroxybenzoate |
| InChIKey | JMBYJYPJYHTGKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C(Cl)(Cl)Cl)OC(=O)C1=CC=CC=C1O |
Computed by PubChem (NCBI)