Products 2376841-18-6
CAS 2376841-18-6 is the registry number for GABAA receptor agent 7. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(4-chlorophenyl)methyl]-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 2376841-18-6) is a chemical compound with the molecular formula C18H13ClN4O and a molecular weight of 336.8 g/mol. IUPAC name: 5-[(4-chlorophenyl)methyl]-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: NJCGLYYAPMJZLT-UHFFFAOYSA-N.
| Molecular formula | C18H13ClN4O |
|---|---|
| Molecular weight | 336.8 g/mol |
| IUPAC name | 5-[(4-chlorophenyl)methyl]-2-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | NJCGLYYAPMJZLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=NC(=CC(=O)N3N2)CC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)
Synonyms:
GABAA receptor agent 7, orb1688984