Products 2376841-54-0
CAS 2376841-54-0 is the registry number for GABAA receptor agent 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-benzyl-2-(4-methylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 2376841-54-0) is a chemical compound with the molecular formula C19H16N4O and a molecular weight of 316.4 g/mol. IUPAC name: 5-benzyl-2-(4-methylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: CBSMOYQXHBJFIG-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 5-benzyl-2-(4-methylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | CBSMOYQXHBJFIG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=NC(=CC(=O)N3N2)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
GABAA receptor agent 8, orb1689206