CAS 2783961-64-6 is the registry number for PRMT5-IN-52. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CAS 2783961-64-6) is a chemical compound with the molecular formula C19H16N4O and a molecular weight of 316.4 g/mol. IUPAC name: 6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: SULGLKHDCJKSLZ-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 6-(4-phenylmethoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | SULGLKHDCJKSLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C3=CC4=C(N=CN=C4N3)N |
Computed by PubChem (NCBI)