Products 2376850-65-4
CAS 2376850-65-4 is the registry number for 8-Benzyl 3-(tert-butyl) (1R,2R,5S)-2-formyl-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-O-benzyl 3-O-tert-butyl (1R,2R,5S)-2-formyl-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate (CAS 2376850-65-4) is a chemical compound with the molecular formula C20H26N2O5 and a molecular weight of 374.4 g/mol. IUPAC name: 8-O-benzyl 3-O-tert-butyl (1R,2R,5S)-2-formyl-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate. InChIKey: JKFDWAOXWHIMAK-BBWFWOEESA-N.
| Molecular formula | C20H26N2O5 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 8-O-benzyl 3-O-tert-butyl (1R,2R,5S)-2-formyl-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate |
| InChIKey | JKFDWAOXWHIMAK-BBWFWOEESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC[C@H]([C@@H]1C=O)N2C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)