CAS 88150-52-1 appears in our catalog under these names: Deschloro Amlodipine , Amlodipine Impurity 46, Deschloro Amlodipine, >95% (HPLC), Deschloro amlodipine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 5mg.
3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-6-methyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 88150-52-1) is a chemical compound with the molecular formula C20H26N2O5 and a molecular weight of 374.4 g/mol. IUPAC name: 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-6-methyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: PEBXGLALMHVYPY-UHFFFAOYSA-N.
| Molecular formula | C20H26N2O5 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-6-methyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | PEBXGLALMHVYPY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2)C(=O)OC)C)COCCN |
Computed by PubChem (NCBI)