CAS 141996-98-7 appears in our catalog under these names: Itopride Impurity H(Itopride N-Oxide), Itopride N-Oxide, Itopride Impurity 4(N-Oxide), Itopride N-Oxide, >95% (HPLC), Itopride N-Oxide, 99.84%. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
2-[4-[[(3,4-dimethoxybenzoyl)amino]methyl]phenoxy]-N,N-dimethylethanamine oxide (CAS 141996-98-7) is a chemical compound with the molecular formula C20H26N2O5 and a molecular weight of 374.4 g/mol. IUPAC name: 2-[4-[[(3,4-dimethoxybenzoyl)amino]methyl]phenoxy]-N,N-dimethylethanamine oxide. InChIKey: PZXRVVNIISGQFI-UHFFFAOYSA-N.
| Molecular formula | C20H26N2O5 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 2-[4-[[(3,4-dimethoxybenzoyl)amino]methyl]phenoxy]-N,N-dimethylethanamine oxide |
| InChIKey | PZXRVVNIISGQFI-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C=C2)OC)OC)[O-] |
Computed by PubChem (NCBI)