Products 2377005-03-1
CAS 2377005-03-1 is the registry number for rac-tert-Butyl (3R,3aR,7aR)-3-(aminomethyl)-octahydro-1H-indole-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (3R,3aR,7aR)-3-(aminomethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (CAS 2377005-03-1) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl (3R,3aR,7aR)-3-(aminomethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate. InChIKey: ATCOIOKEDSKXOO-IJLUTSLNSA-N.
| Molecular formula | C14H26N2O2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | tert-butyl (3R,3aR,7aR)-3-(aminomethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| InChIKey | ATCOIOKEDSKXOO-IJLUTSLNSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H]2[C@H]1CCCC2)CN |
Computed by PubChem (NCBI)