CAS 2377030-61-8 is the registry number for 1-(1-(Propan-2-yl)-1H-pyrazol-5-yl)bicyclo(2.1.1)hexane-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2-propan-2-ylpyrazol-3-yl)bicyclo[2.1.1]hexane-5-carboxylic acid (CAS 2377030-61-8) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: 1-(2-propan-2-ylpyrazol-3-yl)bicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: IFFZWSDJGFSKCO-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 1-(2-propan-2-ylpyrazol-3-yl)bicyclo[2.1.1]hexane-5-carboxylic acid |
| InChIKey | IFFZWSDJGFSKCO-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=CC=N1)C23CCC(C2)C3C(=O)O |
Computed by PubChem (NCBI)