CAS 2377032-30-7 is the registry number for 6-(3-(Aminomethyl)phenyl)pyrimidine-2,4-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-[3-(aminomethyl)phenyl]pyrimidine-2,4-diamine;dihydrochloride (CAS 2377032-30-7) is a chemical compound with the molecular formula C11H15Cl2N5 and a molecular weight of 288.17 g/mol. IUPAC name: 6-[3-(aminomethyl)phenyl]pyrimidine-2,4-diamine;dihydrochloride. InChIKey: FXLJEVZFNVHODB-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N5 |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | 6-[3-(aminomethyl)phenyl]pyrimidine-2,4-diamine;dihydrochloride |
| InChIKey | FXLJEVZFNVHODB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=NC(=N2)N)N)CN.Cl.Cl |
Computed by PubChem (NCBI)