Products 2377032-48-7
CAS 2377032-48-7 is the registry number for 4-Methanesulfonyl-2,2-dimethylpyrrolidine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2-dimethyl-4-methylsulfonylpyrrolidine;hydrochloride (CAS 2377032-48-7) is a chemical compound with the molecular formula C7H16ClNO2S and a molecular weight of 213.73 g/mol. IUPAC name: 2,2-dimethyl-4-methylsulfonylpyrrolidine;hydrochloride. InChIKey: BMPKZNDOPZCJLR-UHFFFAOYSA-N.
| Molecular formula | C7H16ClNO2S |
|---|---|
| Molecular weight | 213.73 g/mol |
| IUPAC name | 2,2-dimethyl-4-methylsulfonylpyrrolidine;hydrochloride |
| InChIKey | BMPKZNDOPZCJLR-UHFFFAOYSA-N |
| SMILES | CC1(CC(CN1)S(=O)(=O)C)C.Cl |
Computed by PubChem (NCBI)