CAS 2377032-59-0 is the registry number for 3-Phenyloxan-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-phenyloxan-3-amine;hydrochloride (CAS 2377032-59-0) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-phenyloxan-3-amine;hydrochloride. InChIKey: OEUQJLILUASZDU-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-phenyloxan-3-amine;hydrochloride |
| InChIKey | OEUQJLILUASZDU-UHFFFAOYSA-N |
| SMILES | C1CC(COC1)(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)