Products 2377033-56-0
CAS 2377033-56-0 is the registry number for 6,6-Dimethylspiro(3.3)heptane-2,2-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6,6-dimethylspiro[3.3]heptane-2,2-dicarboxylic acid (CAS 2377033-56-0) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: 6,6-dimethylspiro[3.3]heptane-2,2-dicarboxylic acid. InChIKey: TWSHSXHNCIFWPK-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 6,6-dimethylspiro[3.3]heptane-2,2-dicarboxylic acid |
| InChIKey | TWSHSXHNCIFWPK-UHFFFAOYSA-N |
| SMILES | CC1(CC2(C1)CC(C2)(C(=O)O)C(=O)O)C |
Computed by PubChem (NCBI)