Products 2377034-49-4
CAS 2377034-49-4 is the registry number for 6,6,8,8-Tetramethyl-7-oxa-1-azaspiro(3.5)nonane. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6,6,8,8-tetramethyl-7-oxa-1-azaspiro[3.5]nonane (CAS 2377034-49-4) is a chemical compound with the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. IUPAC name: 6,6,8,8-tetramethyl-7-oxa-1-azaspiro[3.5]nonane. InChIKey: ISPMQSXTIVCCGT-UHFFFAOYSA-N.
| Molecular formula | C11H21NO |
|---|---|
| Molecular weight | 183.29 g/mol |
| IUPAC name | 6,6,8,8-tetramethyl-7-oxa-1-azaspiro[3.5]nonane |
| InChIKey | ISPMQSXTIVCCGT-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CCN2)CC(O1)(C)C)C |
Computed by PubChem (NCBI)