CAS 2377035-00-0 is the registry number for Potassium 2-(pyridazin-3-yl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Potassium 2-pyridazin-3-ylacetate (CAS 2377035-00-0) is a chemical compound with the molecular formula C6H5KN2O2 and a molecular weight of 176.21 g/mol. IUPAC name: potassium 2-pyridazin-3-ylacetate. InChIKey: ALHYZDCQLDWQGD-UHFFFAOYSA-M.
| Molecular formula | C6H5KN2O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | potassium 2-pyridazin-3-ylacetate |
| InChIKey | ALHYZDCQLDWQGD-UHFFFAOYSA-M |
| SMILES | C1=CC(=NN=C1)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)