CAS 74908-86-4 is the registry number for Potassium 2,2-dicyano-1-ethoxyethen-1-olate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium 2,2-dicyano-1-ethoxyethenolate (CAS 74908-86-4) is a chemical compound with the molecular formula C6H5KN2O2 and a molecular weight of 176.21 g/mol. IUPAC name: potassium 2,2-dicyano-1-ethoxyethenolate. InChIKey: VPECMAWSZTYQJH-UHFFFAOYSA-M.
| Molecular formula | C6H5KN2O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | potassium 2,2-dicyano-1-ethoxyethenolate |
| InChIKey | VPECMAWSZTYQJH-UHFFFAOYSA-M |
| SMILES | CCOC(=C(C#N)C#N)[O-].[K+] |
Computed by PubChem (NCBI)