CAS 2377035-91-9 appears in our catalog under these names: 2,2-Difluoro-1-(pyridin-2-yl)ethan-1-amine dihydrochloride, 95%, 2,2-Difluoro-1-(pyridin-2-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,2-difluoro-1-pyridin-2-ylethanamine;dihydrochloride (CAS 2377035-91-9) is a chemical compound with the molecular formula C7H10Cl2F2N2 and a molecular weight of 231.07 g/mol. IUPAC name: 2,2-difluoro-1-pyridin-2-ylethanamine;dihydrochloride. InChIKey: GCXHKHDYTYCFQK-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2F2N2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 2,2-difluoro-1-pyridin-2-ylethanamine;dihydrochloride |
| InChIKey | GCXHKHDYTYCFQK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(C(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)