CAS 2708341-95-9 is the registry number for (R)-1-(3,5-DIFLUOROPYRIDIN-4-YL)ETHAN-1-AMINE DIHYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1R)-1-(3,5-difluoro-4-pyridinyl)ethanamine;dihydrochloride (CAS 2708341-95-9) is a chemical compound with the molecular formula C7H10Cl2F2N2 and a molecular weight of 231.07 g/mol. IUPAC name: (1R)-1-(3,5-difluoro-4-pyridinyl)ethanamine;dihydrochloride. InChIKey: XNWOAJFRNOASPD-RZFWHQLPSA-N.
| Molecular formula | C7H10Cl2F2N2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | (1R)-1-(3,5-difluoro-4-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | XNWOAJFRNOASPD-RZFWHQLPSA-N |
| SMILES | C[C@H](C1=C(C=NC=C1F)F)N.Cl.Cl |
Computed by PubChem (NCBI)