Products 2377238-62-3
CAS 2377238-62-3 appears in our catalog under these names: (R)-3-Amino-2-(4-(hydroxymethyl)phenyl)-N-(isoquinolin-6-yl)propanamide, (R)-AR-13503, 98.20%. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 5 mg, 10 mg.
(2R)-3-amino-2-[4-(hydroxymethyl)phenyl]-N-isoquinolin-6-ylpropanamide (CAS 2377238-62-3) is a chemical compound with the molecular formula C19H19N3O2 and a molecular weight of 321.4 g/mol. IUPAC name: (2R)-3-amino-2-[4-(hydroxymethyl)phenyl]-N-isoquinolin-6-ylpropanamide. InChIKey: LTXBFJFJUIJOQE-SFHVURJKSA-N.
| Molecular formula | C19H19N3O2 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (2R)-3-amino-2-[4-(hydroxymethyl)phenyl]-N-isoquinolin-6-ylpropanamide |
| InChIKey | LTXBFJFJUIJOQE-SFHVURJKSA-N |
| SMILES | C1=CC(=CC=C1CO)[C@H](CN)C(=O)NC2=CC3=C(C=C2)C=NC=C3 |
Computed by PubChem (NCBI)