CAS 2377355-38-7 is the registry number for tert-Butyl 7-fluoro-1-oxo-1,3-dihydrospiro[indene-2,4'-piperidine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-fluoro-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate (CAS 2377355-38-7) is a chemical compound with the molecular formula C18H22FNO3 and a molecular weight of 319.4 g/mol. IUPAC name: tert-butyl 4-fluoro-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate. InChIKey: MBUVURFUVHCVTQ-UHFFFAOYSA-N.
| Molecular formula | C18H22FNO3 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | tert-butyl 4-fluoro-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
| InChIKey | MBUVURFUVHCVTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC3=C(C2=O)C(=CC=C3)F |
Computed by PubChem (NCBI)