CAS 910442-55-6 appears in our catalog under these names: tert-Butyl 6-fluoro-3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, 97%, 97%, tert-Butyl 6-fluoro-3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl 6-fluoro-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate (CAS 910442-55-6) is a chemical compound with the molecular formula C18H22FNO3 and a molecular weight of 319.4 g/mol. IUPAC name: tert-butyl 6-fluoro-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate. InChIKey: BHMZKFCDJYJFJH-UHFFFAOYSA-N.
| Molecular formula | C18H22FNO3 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | tert-butyl 6-fluoro-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| InChIKey | BHMZKFCDJYJFJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=C2C=C(C=C3)F |
Computed by PubChem (NCBI)