Products 2377605-66-6
CAS 2377605-66-6 appears in our catalog under these names: [4-Chloro-3-(pyrrolidin-1-yl)phenyl]boronic acid, 96%, (4-Chloro-3-(pyrrolidin-1-yl)phenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(4-chloro-3-pyrrolidin-1-ylphenyl)boronic acid (CAS 2377605-66-6) is a chemical compound with the molecular formula C10H13BClNO2 and a molecular weight of 225.48 g/mol. IUPAC name: (4-chloro-3-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: KEXPBXMZJWYKDL-UHFFFAOYSA-N.
| Molecular formula | C10H13BClNO2 |
|---|---|
| Molecular weight | 225.48 g/mol |
| IUPAC name | (4-chloro-3-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | KEXPBXMZJWYKDL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)N2CCCC2)(O)O |
Computed by PubChem (NCBI)