Products 2377605-72-4

CAS 2377605-72-4 is the registry number for 4-Fluoro-3-propoxy-5-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[4-fluoro-3-propoxy-5-(trifluoromethyl)phenyl]boronic acid (CAS 2377605-72-4) is a chemical compound with the molecular formula C10H11BF4O3 and a molecular weight of 266.00 g/mol. IUPAC name: [4-fluoro-3-propoxy-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: KABKCLSFCLORND-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BF4O3
Molecular weight266.00 g/mol
IUPAC name[4-fluoro-3-propoxy-5-(trifluoromethyl)phenyl]boronic acid
InChIKeyKABKCLSFCLORND-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)OCCC)F)C(F)(F)F)(O)O

Computed by PubChem (NCBI)