CAS 871126-19-1 is the registry number for 4-Butoxy-2,3,5,6-tetrafluorophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4-butoxy-2,3,5,6-tetrafluorophenyl)boronic acid (CAS 871126-19-1) is a chemical compound with the molecular formula C10H11BF4O3 and a molecular weight of 266.00 g/mol. IUPAC name: (4-butoxy-2,3,5,6-tetrafluorophenyl)boronic acid. InChIKey: DXYUAQQPCWNJQX-UHFFFAOYSA-N.
| Molecular formula | C10H11BF4O3 |
|---|---|
| Molecular weight | 266.00 g/mol |
| IUPAC name | (4-butoxy-2,3,5,6-tetrafluorophenyl)boronic acid |
| InChIKey | DXYUAQQPCWNJQX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1F)F)OCCCC)F)F)(O)O |
Computed by PubChem (NCBI)