CAS 2377606-75-0 appears in our catalog under these names: 5-Bromo-2-fluoro-3-(trifluoroacetamido)phenylboronic acid, 98%, (5-Bromo-2-fluoro-3-(2,2,2-trifluoroacetamido)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
[5-bromo-2-fluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]boronic acid (CAS 2377606-75-0) is a chemical compound with the molecular formula C8H5BBrF4NO3 and a molecular weight of 329.84 g/mol. IUPAC name: [5-bromo-2-fluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]boronic acid. InChIKey: LDSFTZCDVJAKJK-UHFFFAOYSA-N.
| Molecular formula | C8H5BBrF4NO3 |
|---|---|
| Molecular weight | 329.84 g/mol |
| IUPAC name | [5-bromo-2-fluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]boronic acid |
| InChIKey | LDSFTZCDVJAKJK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)NC(=O)C(F)(F)F)Br)(O)O |
Computed by PubChem (NCBI)