CAS 2377608-69-8 is the registry number for 3-Bromo-2-fluoro-5-(trifluoroacetamido)phenylboronic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-bromo-2-fluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]boronic acid (CAS 2377608-69-8) is a chemical compound with the molecular formula C8H5BBrF4NO3 and a molecular weight of 329.84 g/mol. IUPAC name: [3-bromo-2-fluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]boronic acid. InChIKey: XDYUKESTDWVVTJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BBrF4NO3 |
|---|---|
| Molecular weight | 329.84 g/mol |
| IUPAC name | [3-bromo-2-fluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]boronic acid |
| InChIKey | XDYUKESTDWVVTJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)Br)NC(=O)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)