CAS 2377606-80-7 appears in our catalog under these names: 6-Chloro-1-methylindazole-3-boronic acid pinacol ester, 95%, 6-Chloro-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-chloro-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 2377606-80-7) is a chemical compound with the molecular formula C14H18BClN2O2 and a molecular weight of 292.57 g/mol. IUPAC name: 6-chloro-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: TZBSRLSNPJYTAP-UHFFFAOYSA-N.
| Molecular formula | C14H18BClN2O2 |
|---|---|
| Molecular weight | 292.57 g/mol |
| IUPAC name | 6-chloro-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | TZBSRLSNPJYTAP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C3=C2C=CC(=C3)Cl)C |
Computed by PubChem (NCBI)