Products 2874357-83-0
CAS 2874357-83-0 is the registry number for 7-Chloro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 2874357-83-0) is a chemical compound with the molecular formula C14H18BClN2O2 and a molecular weight of 292.57 g/mol. IUPAC name: 7-chloro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: NLVZETLRJCAERK-UHFFFAOYSA-N.
| Molecular formula | C14H18BClN2O2 |
|---|---|
| Molecular weight | 292.57 g/mol |
| IUPAC name | 7-chloro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | NLVZETLRJCAERK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CN(N=C3C(=C2)Cl)C |
Computed by PubChem (NCBI)