CAS 2377607-09-3 appears in our catalog under these names: Methyl 2-{[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamido}acetate, 98%, Methyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamido)acetate 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]acetate (CAS 2377607-09-3) is a chemical compound with the molecular formula C16H22BNO5 and a molecular weight of 319.2 g/mol. IUPAC name: methyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]acetate. InChIKey: IIGSNCMXRQFHAH-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO5 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | methyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]acetate |
| InChIKey | IIGSNCMXRQFHAH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NCC(=O)OC |
Computed by PubChem (NCBI)