CAS 1030269-28-3 appears in our catalog under these names: 3-Succinamidophenylboronic acid, pinacol ester, 96%, 3-Succinamidophenylboronic acid, pinacol ester, 96%, 96%, N-(3-(4,4,5,5-TetraMethyl-(1,3,2)dioxaborolan-2-yl)-phenyl)succinaMic acid, 4-Oxo-4-((3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)amino)butanoic acid, 96%. Offered by: Combi-blocks, Chemat, Biosynth, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg, 2g.
4-oxo-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]butanoic acid (CAS 1030269-28-3) is a chemical compound with the molecular formula C16H22BNO5 and a molecular weight of 319.2 g/mol. IUPAC name: 4-oxo-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]butanoic acid. InChIKey: IOFRLFIFTQTDDV-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO5 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 4-oxo-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]butanoic acid |
| InChIKey | IOFRLFIFTQTDDV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)