CAS 2377607-57-1 appears in our catalog under these names: 5-Methyl-[1,2,3,4]tetrazolo[1,5-a]pyridino-6-boronic acid, 95%, (5-Methyltetrazolo(1,5-a)pyridin-6-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(5-methyltetrazolo[1,5-a]pyridin-6-yl)boronic acid (CAS 2377607-57-1) is a chemical compound with the molecular formula C6H7BN4O2 and a molecular weight of 177.96 g/mol. IUPAC name: (5-methyltetrazolo[1,5-a]pyridin-6-yl)boronic acid. InChIKey: REJTUOUOBFPJIB-UHFFFAOYSA-N.
| Molecular formula | C6H7BN4O2 |
|---|---|
| Molecular weight | 177.96 g/mol |
| IUPAC name | (5-methyltetrazolo[1,5-a]pyridin-6-yl)boronic acid |
| InChIKey | REJTUOUOBFPJIB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N2C(=NN=N2)C=C1)C)(O)O |
Computed by PubChem (NCBI)