CAS 2426692-32-0 is the registry number for (1-Methyl-1H-[1,2,3]triazolo[4,5-b]pyridin-6-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1-methyltriazolo[4,5-b]pyridin-6-yl)boronic acid (CAS 2426692-32-0) is a chemical compound with the molecular formula C6H7BN4O2 and a molecular weight of 177.96 g/mol. IUPAC name: (1-methyltriazolo[4,5-b]pyridin-6-yl)boronic acid. InChIKey: HMQQHDIDNVFYSJ-UHFFFAOYSA-N.
| Molecular formula | C6H7BN4O2 |
|---|---|
| Molecular weight | 177.96 g/mol |
| IUPAC name | (1-methyltriazolo[4,5-b]pyridin-6-yl)boronic acid |
| InChIKey | HMQQHDIDNVFYSJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N=C1)N=NN2C)(O)O |
Computed by PubChem (NCBI)