CAS 2377608-40-5 is the registry number for 4-(tert-Butyldimethylsilyloxy)methyl-3-methylphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylphenyl]boronic acid (CAS 2377608-40-5) is a chemical compound with the molecular formula C14H25BO3Si and a molecular weight of 280.24 g/mol. IUPAC name: [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylphenyl]boronic acid. InChIKey: LGWCJRIVXJRWOC-UHFFFAOYSA-N.
| Molecular formula | C14H25BO3Si |
|---|---|
| Molecular weight | 280.24 g/mol |
| IUPAC name | [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylphenyl]boronic acid |
| InChIKey | LGWCJRIVXJRWOC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CO[Si](C)(C)C(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)